C18H21NO3S2 — CID 9071791
N-(3-methylsulfonylphenyl)-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carboxamide (PubChem CID 9071791) has the molecular formula C18H21NO3S2 and a molecular weight of 363.50 g/mol. Its IUPAC name is N-(3-methylsulfonylphenyl)-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carboxamide.
| Compound Name | N-(3-methylsulfonylphenyl)-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 9071791 |
| Molecular Formula | C18H21NO3S2 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | N-(3-methylsulfonylphenyl)-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carboxamide |
| SMILES | CS(=O)(=O)c1cccc(NC(=O)c2cc3c(s2)CCCCCC3)c1 |
| InChI | InChI=1S/C18H21NO3S2/c1-24(21,22)15-9-6-8-14(12-15)19-18(20)17-11-13-7-4-2-3-5-10-16(13)23-17/h6,8-9,11-12H,2-5,7,10H2,1H3,(H,19,20) |
| InChIKey | RWNGCEGQHUKTEW-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |