C17H17NO2S — CID 106912608
N-(3-formylphenyl)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carboxamide (PubChem CID 106912608) has the molecular formula C17H17NO2S and a molecular weight of 299.39 g/mol. Its IUPAC name is N-(3-formylphenyl)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carboxamide.
| Compound Name | N-(3-formylphenyl)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 106912608 |
| Molecular Formula | C17H17NO2S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | N-(3-formylphenyl)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carboxamide |
| SMILES | O=Cc1cccc(NC(=O)c2cc3c(s2)CCCCC3)c1 |
| InChI | InChI=1S/C17H17NO2S/c19-11-12-5-4-7-14(9-12)18-17(20)16-10-13-6-2-1-3-8-15(13)21-16/h4-5,7,9-11H,1-3,6,8H2,(H,18,20) |
| InChIKey | QRAXBZMAOGEGJV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|