C21H24N2O2S — CID 26993790
N-[3-(cyclopropylcarbamoyl)phenyl]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carboxamide (PubChem CID 26993790) has the molecular formula C21H24N2O2S and a molecular weight of 368.50 g/mol. Its IUPAC name is N-[3-(cyclopropylcarbamoyl)phenyl]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carboxamide.
| Compound Name | N-[3-(cyclopropylcarbamoyl)phenyl]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 26993790 |
| Molecular Formula | C21H24N2O2S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | N-[3-(cyclopropylcarbamoyl)phenyl]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carboxamide |
| SMILES | O=C(NC1CC1)c1cccc(NC(=O)c2cc3c(s2)CCCCCC3)c1 |
| InChI | InChI=1S/C21H24N2O2S/c24-20(22-16-10-11-16)15-7-5-8-17(12-15)23-21(25)19-13-14-6-3-1-2-4-9-18(14)26-19/h5,7-8,12-13,16H,1-4,6,9-11H2,(H,22,24)(H,23,25) |
| InChIKey | JLDMIGLZRHQGPR-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |