C19H23N3O4S2 — CID 25444396
N-[3-[(4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbonylamino)carbamoyl]phenyl]methanesulfonamide (PubChem CID 25444396) has the molecular formula C19H23N3O4S2 and a molecular weight of 421.54 g/mol. Its IUPAC name is N-[3-[(4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbonylamino)carbamoyl]phenyl]methanesulfonamide.
| Compound Name | N-[3-[(4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbonylamino)carbamoyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 25444396 |
| Molecular Formula | C19H23N3O4S2 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | N-[3-[(4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbonylamino)carbamoyl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cccc(C(=O)NNC(=O)c2cc3c(s2)CCCCCC3)c1 |
| InChI | InChI=1S/C19H23N3O4S2/c1-28(25,26)22-15-9-6-8-14(11-15)18(23)20-21-19(24)17-12-13-7-4-2-3-5-10-16(13)27-17/h6,8-9,11-12,22H,2-5,7,10H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | DSLDCVNEGZLWKB-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|