C18H20N2O5S2 — CID 31702422
methyl 3-[(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonylamino)sulfamoyl]benzoate (PubChem CID 31702422) has the molecular formula C18H20N2O5S2 and a molecular weight of 408.50 g/mol. Its IUPAC name is methyl 3-[(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonylamino)sulfamoyl]benzoate.
| Compound Name | methyl 3-[(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonylamino)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 31702422 |
| Molecular Formula | C18H20N2O5S2 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | methyl 3-[(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonylamino)sulfamoyl]benzoate |
| SMILES | COC(=O)c1cccc(S(=O)(=O)NNC(=O)c2cc3c(s2)CCCCC3)c1 |
| InChI | InChI=1S/C18H20N2O5S2/c1-25-18(22)13-7-5-8-14(10-13)27(23,24)20-19-17(21)16-11-12-6-3-2-4-9-15(12)26-16/h5,7-8,10-11,20H,2-4,6,9H2,1H3,(H,19,21) |
| InChIKey | SFTOISHDZHTNGP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|