C19H24N2O3S2 — CID 8500358
N'-(4-propylphenyl)sulfonyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbohydrazide (PubChem CID 8500358) has the molecular formula C19H24N2O3S2 and a molecular weight of 392.55 g/mol. Its IUPAC name is N'-(4-propylphenyl)sulfonyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbohydrazide.
| Compound Name | N'-(4-propylphenyl)sulfonyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 8500358 |
| Molecular Formula | C19H24N2O3S2 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | N'-(4-propylphenyl)sulfonyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbohydrazide |
| SMILES | CCCc1ccc(S(=O)(=O)NNC(=O)c2cc3c(s2)CCCCC3)cc1 |
| InChI | InChI=1S/C19H24N2O3S2/c1-2-6-14-9-11-16(12-10-14)26(23,24)21-20-19(22)18-13-15-7-4-3-5-8-17(15)25-18/h9-13,21H,2-8H2,1H3,(H,20,22) |
| InChIKey | BPUACOMEXNDGFD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|