C14H15BrN2O3S3 — CID 26968592
N'-(5-bromothiophen-2-yl)sulfonyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbohydrazide (PubChem CID 26968592) has the molecular formula C14H15BrN2O3S3 and a molecular weight of 435.39 g/mol. Its IUPAC name is N'-(5-bromothiophen-2-yl)sulfonyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbohydrazide.
| Compound Name | N'-(5-bromothiophen-2-yl)sulfonyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 26968592 |
| Molecular Formula | C14H15BrN2O3S3 |
| Molecular Weight | 435.39 g/mol |
| Exact Mass | 433.94 |
| IUPAC Name | N'-(5-bromothiophen-2-yl)sulfonyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbohydrazide |
| SMILES | O=C(NNS(=O)(=O)c1ccc(Br)s1)c1cc2c(s1)CCCCC2 |
| InChI | InChI=1S/C14H15BrN2O3S3/c15-12-6-7-13(22-12)23(19,20)17-16-14(18)11-8-9-4-2-1-3-5-10(9)21-11/h6-8,17H,1-5H2,(H,16,18) |
| InChIKey | FGXHSFVZHJEOSF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.39 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|