C18H18F4N2O3S2 — CID 60585446
N'-[4-fluoro-3-(trifluoromethyl)phenyl]sulfonyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbohydrazide (PubChem CID 60585446) has the molecular formula C18H18F4N2O3S2 and a molecular weight of 450.48 g/mol. Its IUPAC name is N'-[4-fluoro-3-(trifluoromethyl)phenyl]sulfonyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbohydrazide.
| Compound Name | N'-[4-fluoro-3-(trifluoromethyl)phenyl]sulfonyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 60585446 |
| Molecular Formula | C18H18F4N2O3S2 |
| Molecular Weight | 450.48 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | N'-[4-fluoro-3-(trifluoromethyl)phenyl]sulfonyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbohydrazide |
| SMILES | O=C(NNS(=O)(=O)c1ccc(F)c(C(F)(F)F)c1)c1cc2c(s1)CCCCCC2 |
| InChI | InChI=1S/C18H18F4N2O3S2/c19-14-8-7-12(10-13(14)18(20,21)22)29(26,27)24-23-17(25)16-9-11-5-3-1-2-4-6-15(11)28-16/h7-10,24H,1-6H2,(H,23,25) |
| InChIKey | KKQXKLMPNVZSKW-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|