C20H30N4O3S2 — CID 86934770
N'-(1-tert-butyl-3,5-dimethylpyrazol-4-yl)sulfonyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbohydrazide (PubChem CID 86934770) has the molecular formula C20H30N4O3S2 and a molecular weight of 438.62 g/mol. Its IUPAC name is N'-(1-tert-butyl-3,5-dimethylpyrazol-4-yl)sulfonyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbohydrazide.
| Compound Name | N'-(1-tert-butyl-3,5-dimethylpyrazol-4-yl)sulfonyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 86934770 |
| Molecular Formula | C20H30N4O3S2 |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | N'-(1-tert-butyl-3,5-dimethylpyrazol-4-yl)sulfonyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbohydrazide |
| SMILES | Cc1nn(C(C)(C)C)c(C)c1S(=O)(=O)NNC(=O)c1cc2c(s1)CCCCCC2 |
| InChI | InChI=1S/C20H30N4O3S2/c1-13-18(14(2)24(22-13)20(3,4)5)29(26,27)23-21-19(25)17-12-15-10-8-6-7-9-11-16(15)28-17/h12,23H,6-11H2,1-5H3,(H,21,25) |
| InChIKey | MLJQHHUEIRIAPT-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|