C15H22N4O3S — CID 35431124
[(2R)-1-[2-(4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbonyl)hydrazinyl]-1-oxopropan-2-yl]urea (PubChem CID 35431124) has the molecular formula C15H22N4O3S and a molecular weight of 338.43 g/mol. Its IUPAC name is [(2R)-1-[2-(4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbonyl)hydrazinyl]-1-oxopropan-2-yl]urea.
| Compound Name | [(2R)-1-[2-(4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbonyl)hydrazinyl]-1-oxopropan-2-yl]urea |
|---|---|
| PubChem CID | 35431124 |
| Molecular Formula | C15H22N4O3S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | [(2R)-1-[2-(4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbonyl)hydrazinyl]-1-oxopropan-2-yl]urea |
| SMILES | C[C@@H](NC(N)=O)C(=O)NNC(=O)c1cc2c(s1)CCCCCC2 |
| InChI | InChI=1S/C15H22N4O3S/c1-9(17-15(16)22)13(20)18-19-14(21)12-8-10-6-4-2-3-5-7-11(10)23-12/h8-9H,2-7H2,1H3,(H,18,20)(H,19,21)(H3,16,17,22)/t9-/m1/s1 |
| InChIKey | AOQGQMLITJCRQH-SECBINFHSA-N |
| XLogP | 1.22 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|