C15H21N3O3S — CID 24644258
N-[1-oxo-1-[2-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonyl)hydrazinyl]propan-2-yl]acetamide (PubChem CID 24644258) has the molecular formula C15H21N3O3S and a molecular weight of 323.42 g/mol. Its IUPAC name is N-[1-oxo-1-[2-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonyl)hydrazinyl]propan-2-yl]acetamide.
| Compound Name | N-[1-oxo-1-[2-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonyl)hydrazinyl]propan-2-yl]acetamide |
|---|---|
| PubChem CID | 24644258 |
| Molecular Formula | C15H21N3O3S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | N-[1-oxo-1-[2-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonyl)hydrazinyl]propan-2-yl]acetamide |
| SMILES | CC(=O)NC(C)C(=O)NNC(=O)c1cc2c(s1)CCCCC2 |
| InChI | InChI=1S/C15H21N3O3S/c1-9(16-10(2)19)14(20)17-18-15(21)13-8-11-6-4-3-5-7-12(11)22-13/h8-9H,3-7H2,1-2H3,(H,16,19)(H,17,20)(H,18,21) |
| InChIKey | JIEAMQAYFBPJEA-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|