C20H21N3O4S — CID 134051127
N'-[2-(2-oxo-1,3-benzoxazol-3-yl)propanoyl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbohydrazide (PubChem CID 134051127) has the molecular formula C20H21N3O4S and a molecular weight of 399.47 g/mol. Its IUPAC name is N'-[2-(2-oxo-1,3-benzoxazol-3-yl)propanoyl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbohydrazide.
| Compound Name | N'-[2-(2-oxo-1,3-benzoxazol-3-yl)propanoyl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 134051127 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | N'-[2-(2-oxo-1,3-benzoxazol-3-yl)propanoyl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbohydrazide |
| SMILES | CC(C(=O)NNC(=O)c1cc2c(s1)CCCCC2)n1c(=O)oc2ccccc21 |
| InChI | InChI=1S/C20H21N3O4S/c1-12(23-14-8-5-6-9-15(14)27-20(23)26)18(24)21-22-19(25)17-11-13-7-3-2-4-10-16(13)28-17/h5-6,8-9,11-12H,2-4,7,10H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | CKUWEAQDYVEAHR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 93.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|