C20H23N3O4S2 — CID 31846647
N-cyclopropyl-4-[(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonylamino)carbamoyl]benzenesulfonamide (PubChem CID 31846647) has the molecular formula C20H23N3O4S2 and a molecular weight of 433.56 g/mol. Its IUPAC name is N-cyclopropyl-4-[(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonylamino)carbamoyl]benzenesulfonamide.
| Compound Name | N-cyclopropyl-4-[(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonylamino)carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 31846647 |
| Molecular Formula | C20H23N3O4S2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | N-cyclopropyl-4-[(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonylamino)carbamoyl]benzenesulfonamide |
| SMILES | O=C(NNC(=O)c1cc2c(s1)CCCCC2)c1ccc(S(=O)(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C20H23N3O4S2/c24-19(13-6-10-16(11-7-13)29(26,27)23-15-8-9-15)21-22-20(25)18-12-14-4-2-1-3-5-17(14)28-18/h6-7,10-12,15,23H,1-5,8-9H2,(H,21,24)(H,22,25) |
| InChIKey | KNKUIOPKZIFINY-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|