C21H18FN3O4S2 — CID 27684840
N-[4-[(5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbonylamino)carbamoyl]phenyl]-4-fluorobenzenesulfonamide (PubChem CID 27684840) has the molecular formula C21H18FN3O4S2 and a molecular weight of 459.52 g/mol. Its IUPAC name is N-[4-[(5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbonylamino)carbamoyl]phenyl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[4-[(5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbonylamino)carbamoyl]phenyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 27684840 |
| Molecular Formula | C21H18FN3O4S2 |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.07 |
| IUPAC Name | N-[4-[(5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbonylamino)carbamoyl]phenyl]-4-fluorobenzenesulfonamide |
| SMILES | O=C(NNC(=O)c1cc2c(s1)CCC2)c1ccc(NS(=O)(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C21H18FN3O4S2/c22-15-6-10-17(11-7-15)31(28,29)25-16-8-4-13(5-9-16)20(26)23-24-21(27)19-12-14-2-1-3-18(14)30-19/h4-12,25H,1-3H2,(H,23,26)(H,24,27) |
| InChIKey | DKBACUMZRNMWCZ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|