C20H22FN3O4S2 — CID 46529172
N'-(5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbonyl)-1-(4-fluorophenyl)sulfonylpiperidine-3-carbohydrazide (PubChem CID 46529172) has the molecular formula C20H22FN3O4S2 and a molecular weight of 451.55 g/mol. Its IUPAC name is N'-(5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbonyl)-1-(4-fluorophenyl)sulfonylpiperidine-3-carbohydrazide.
| Compound Name | N'-(5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbonyl)-1-(4-fluorophenyl)sulfonylpiperidine-3-carbohydrazide |
|---|---|
| PubChem CID | 46529172 |
| Molecular Formula | C20H22FN3O4S2 |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | N'-(5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbonyl)-1-(4-fluorophenyl)sulfonylpiperidine-3-carbohydrazide |
| SMILES | O=C(NNC(=O)C1CCCN(S(=O)(=O)c2ccc(F)cc2)C1)c1cc2c(s1)CCC2 |
| InChI | InChI=1S/C20H22FN3O4S2/c21-15-6-8-16(9-7-15)30(27,28)24-10-2-4-14(12-24)19(25)22-23-20(26)18-11-13-3-1-5-17(13)29-18/h6-9,11,14H,1-5,10,12H2,(H,22,25)(H,23,26) |
| InChIKey | QCKFMGXMIKMAFC-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|