C22H25N3O4S2 — CID 89239186
N-[4-[(3S)-3-(prop-2-enoylamino)piperidin-1-yl]sulfonylphenyl]-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxamide (PubChem CID 89239186) has the molecular formula C22H25N3O4S2 and a molecular weight of 459.59 g/mol. Its IUPAC name is N-[4-[(3S)-3-(prop-2-enoylamino)piperidin-1-yl]sulfonylphenyl]-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxamide.
| Compound Name | N-[4-[(3S)-3-(prop-2-enoylamino)piperidin-1-yl]sulfonylphenyl]-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 89239186 |
| Molecular Formula | C22H25N3O4S2 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | N-[4-[(3S)-3-(prop-2-enoylamino)piperidin-1-yl]sulfonylphenyl]-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxamide |
| SMILES | C=CC(=O)N[C@H]1CCCN(S(=O)(=O)c2ccc(NC(=O)c3cc4c(s3)CCC4)cc2)C1 |
| InChI | InChI=1S/C22H25N3O4S2/c1-2-21(26)23-17-6-4-12-25(14-17)31(28,29)18-10-8-16(9-11-18)24-22(27)20-13-15-5-3-7-19(15)30-20/h2,8-11,13,17H,1,3-7,12,14H2,(H,23,26)(H,24,27)/t17-/m0/s1 |
| InChIKey | ZBYAHOHCZBWYDG-KRWDZBQOSA-N |
| XLogP | 2.94 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|