C25H25N3O4S2 — CID 89237200
N-[4-[[5-(prop-2-enoylamino)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]sulfonyl]phenyl]-1-benzothiophene-2-carboxamide (PubChem CID 89237200) has the molecular formula C25H25N3O4S2 and a molecular weight of 495.63 g/mol. Its IUPAC name is N-[4-[[5-(prop-2-enoylamino)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]sulfonyl]phenyl]-1-benzothiophene-2-carboxamide.
| Compound Name | N-[4-[[5-(prop-2-enoylamino)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]sulfonyl]phenyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 89237200 |
| Molecular Formula | C25H25N3O4S2 |
| Molecular Weight | 495.63 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | N-[4-[[5-(prop-2-enoylamino)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]sulfonyl]phenyl]-1-benzothiophene-2-carboxamide |
| SMILES | C=CC(=O)NC1CC2CN(S(=O)(=O)c3ccc(NC(=O)c4cc5ccccc5s4)cc3)CC2C1 |
| InChI | InChI=1S/C25H25N3O4S2/c1-2-24(29)26-20-11-17-14-28(15-18(17)12-20)34(31,32)21-9-7-19(8-10-21)27-25(30)23-13-16-5-3-4-6-22(16)33-23/h2-10,13,17-18,20H,1,11-12,14-15H2,(H,26,29)(H,27,30) |
| InChIKey | JHSGVWOATRBOKR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.63 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|