C17H15NO3S2 — CID 42022646
N-(4-ethylsulfonylphenyl)-1-benzothiophene-2-carboxamide (PubChem CID 42022646) has the molecular formula C17H15NO3S2 and a molecular weight of 345.45 g/mol. Its IUPAC name is N-(4-ethylsulfonylphenyl)-1-benzothiophene-2-carboxamide.
| Compound Name | N-(4-ethylsulfonylphenyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 42022646 |
| Molecular Formula | C17H15NO3S2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | N-(4-ethylsulfonylphenyl)-1-benzothiophene-2-carboxamide |
| SMILES | CCS(=O)(=O)c1ccc(NC(=O)c2cc3ccccc3s2)cc1 |
| InChI | InChI=1S/C17H15NO3S2/c1-2-23(20,21)14-9-7-13(8-10-14)18-17(19)16-11-12-5-3-4-6-15(12)22-16/h3-11H,2H2,1H3,(H,18,19) |
| InChIKey | WRACWAKNJKBHGM-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |