C21H23N3O3S2 — CID 32999319
N-[3-(4-ethylpiperazin-1-yl)sulfonylphenyl]-1-benzothiophene-2-carboxamide (PubChem CID 32999319) has the molecular formula C21H23N3O3S2 and a molecular weight of 429.57 g/mol. Its IUPAC name is N-[3-(4-ethylpiperazin-1-yl)sulfonylphenyl]-1-benzothiophene-2-carboxamide.
| Compound Name | N-[3-(4-ethylpiperazin-1-yl)sulfonylphenyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 32999319 |
| Molecular Formula | C21H23N3O3S2 |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | N-[3-(4-ethylpiperazin-1-yl)sulfonylphenyl]-1-benzothiophene-2-carboxamide |
| SMILES | CCN1CCN(S(=O)(=O)c2cccc(NC(=O)c3cc4ccccc4s3)c2)CC1 |
| InChI | InChI=1S/C21H23N3O3S2/c1-2-23-10-12-24(13-11-23)29(26,27)18-8-5-7-17(15-18)22-21(25)20-14-16-6-3-4-9-19(16)28-20/h3-9,14-15H,2,10-13H2,1H3,(H,22,25) |
| InChIKey | HGAISRGVUOTOOX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |