C19H26Cl2N4O3S — CID 119946153
2-amino-N-[3-(4-ethylpiperazin-1-yl)sulfonylphenyl]benzamide;dihydrochloride (PubChem CID 119946153) has the molecular formula C19H26Cl2N4O3S and a molecular weight of 461.42 g/mol. Its IUPAC name is 2-amino-N-[3-(4-ethylpiperazin-1-yl)sulfonylphenyl]benzamide;dihydrochloride.
| Compound Name | 2-amino-N-[3-(4-ethylpiperazin-1-yl)sulfonylphenyl]benzamide;dihydrochloride |
|---|---|
| PubChem CID | 119946153 |
| Molecular Formula | C19H26Cl2N4O3S |
| Molecular Weight | 461.42 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | 2-amino-N-[3-(4-ethylpiperazin-1-yl)sulfonylphenyl]benzamide;dihydrochloride |
| SMILES | CCN1CCN(S(=O)(=O)c2cccc(NC(=O)c3ccccc3N)c2)CC1.Cl.Cl |
| InChI | InChI=1S/C19H24N4O3S.2ClH/c1-2-22-10-12-23(13-11-22)27(25,26)16-7-5-6-15(14-16)21-19(24)17-8-3-4-9-18(17)20;;/h3-9,14H,2,10-13,20H2,1H3,(H,21,24);2*1H |
| InChIKey | ZCRNTTGEIAUUKB-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.42 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|