C20H29N5O5S — CID 55910713
2-(4-ethyl-2,3-dioxopiperazin-1-yl)-N-[3-(4-ethylpiperazin-1-yl)sulfonylphenyl]acetamide (PubChem CID 55910713) has the molecular formula C20H29N5O5S and a molecular weight of 451.55 g/mol. Its IUPAC name is 2-(4-ethyl-2,3-dioxopiperazin-1-yl)-N-[3-(4-ethylpiperazin-1-yl)sulfonylphenyl]acetamide.
| Compound Name | 2-(4-ethyl-2,3-dioxopiperazin-1-yl)-N-[3-(4-ethylpiperazin-1-yl)sulfonylphenyl]acetamide |
|---|---|
| PubChem CID | 55910713 |
| Molecular Formula | C20H29N5O5S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | 2-(4-ethyl-2,3-dioxopiperazin-1-yl)-N-[3-(4-ethylpiperazin-1-yl)sulfonylphenyl]acetamide |
| SMILES | CCN1CCN(S(=O)(=O)c2cccc(NC(=O)CN3CCN(CC)C(=O)C3=O)c2)CC1 |
| InChI | InChI=1S/C20H29N5O5S/c1-3-22-8-12-25(13-9-22)31(29,30)17-7-5-6-16(14-17)21-18(26)15-24-11-10-23(4-2)19(27)20(24)28/h5-7,14H,3-4,8-13,15H2,1-2H3,(H,21,26) |
| InChIKey | BJXNCLDRRQDMNE-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 110.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|