C21H25N7O3S — CID 55630981
N-[3-(4-ethylpiperazin-1-yl)sulfonylphenyl]-2-[4-(tetrazol-1-yl)phenyl]acetamide (PubChem CID 55630981) has the molecular formula C21H25N7O3S and a molecular weight of 455.54 g/mol. Its IUPAC name is N-[3-(4-ethylpiperazin-1-yl)sulfonylphenyl]-2-[4-(tetrazol-1-yl)phenyl]acetamide.
| Compound Name | N-[3-(4-ethylpiperazin-1-yl)sulfonylphenyl]-2-[4-(tetrazol-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 55630981 |
| Molecular Formula | C21H25N7O3S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | N-[3-(4-ethylpiperazin-1-yl)sulfonylphenyl]-2-[4-(tetrazol-1-yl)phenyl]acetamide |
| SMILES | CCN1CCN(S(=O)(=O)c2cccc(NC(=O)Cc3ccc(-n4cnnn4)cc3)c2)CC1 |
| InChI | InChI=1S/C21H25N7O3S/c1-2-26-10-12-27(13-11-26)32(30,31)20-5-3-4-18(15-20)23-21(29)14-17-6-8-19(9-7-17)28-16-22-24-25-28/h3-9,15-16H,2,10-14H2,1H3,(H,23,29) |
| InChIKey | LAQQXZRGPTVVCZ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |