C20H24N6O3S — CID 91954160
N-[3-(2-methylpropylsulfamoylmethyl)phenyl]-2-[4-(tetrazol-1-yl)phenyl]acetamide (PubChem CID 91954160) has the molecular formula C20H24N6O3S and a molecular weight of 428.52 g/mol. Its IUPAC name is N-[3-(2-methylpropylsulfamoylmethyl)phenyl]-2-[4-(tetrazol-1-yl)phenyl]acetamide.
| Compound Name | N-[3-(2-methylpropylsulfamoylmethyl)phenyl]-2-[4-(tetrazol-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 91954160 |
| Molecular Formula | C20H24N6O3S |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | N-[3-(2-methylpropylsulfamoylmethyl)phenyl]-2-[4-(tetrazol-1-yl)phenyl]acetamide |
| SMILES | CC(C)CNS(=O)(=O)Cc1cccc(NC(=O)Cc2ccc(-n3cnnn3)cc2)c1 |
| InChI | InChI=1S/C20H24N6O3S/c1-15(2)12-22-30(28,29)13-17-4-3-5-18(10-17)23-20(27)11-16-6-8-19(9-7-16)26-14-21-24-25-26/h3-10,14-15,22H,11-13H2,1-2H3,(H,23,27) |
| InChIKey | HGURGJBNBRZGRQ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 118.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |