C23H21ClN6O3S — CID 55631238
N-[4-chloro-3-[ethyl(phenyl)sulfamoyl]phenyl]-2-[4-(tetrazol-1-yl)phenyl]acetamide (PubChem CID 55631238) has the molecular formula C23H21ClN6O3S and a molecular weight of 496.98 g/mol. Its IUPAC name is N-[4-chloro-3-[ethyl(phenyl)sulfamoyl]phenyl]-2-[4-(tetrazol-1-yl)phenyl]acetamide.
| Compound Name | N-[4-chloro-3-[ethyl(phenyl)sulfamoyl]phenyl]-2-[4-(tetrazol-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 55631238 |
| Molecular Formula | C23H21ClN6O3S |
| Molecular Weight | 496.98 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | N-[4-chloro-3-[ethyl(phenyl)sulfamoyl]phenyl]-2-[4-(tetrazol-1-yl)phenyl]acetamide |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1cc(NC(=O)Cc2ccc(-n3cnnn3)cc2)ccc1Cl |
| InChI | InChI=1S/C23H21ClN6O3S/c1-2-30(20-6-4-3-5-7-20)34(32,33)22-15-18(10-13-21(22)24)26-23(31)14-17-8-11-19(12-9-17)29-16-25-27-28-29/h3-13,15-16H,2,14H2,1H3,(H,26,31) |
| InChIKey | DJDGGIUNIIBHLB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.98 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |