C20H17Cl2N3O3S — CID 52893457
2-chloro-N-[4-chloro-3-[ethyl(phenyl)sulfamoyl]phenyl]pyridine-3-carboxamide (PubChem CID 52893457) has the molecular formula C20H17Cl2N3O3S and a molecular weight of 450.35 g/mol. Its IUPAC name is 2-chloro-N-[4-chloro-3-[ethyl(phenyl)sulfamoyl]phenyl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[4-chloro-3-[ethyl(phenyl)sulfamoyl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 52893457 |
| Molecular Formula | C20H17Cl2N3O3S |
| Molecular Weight | 450.35 g/mol |
| Exact Mass | 449.04 |
| IUPAC Name | 2-chloro-N-[4-chloro-3-[ethyl(phenyl)sulfamoyl]phenyl]pyridine-3-carboxamide |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1cc(NC(=O)c2cccnc2Cl)ccc1Cl |
| InChI | InChI=1S/C20H17Cl2N3O3S/c1-2-25(15-7-4-3-5-8-15)29(27,28)18-13-14(10-11-17(18)21)24-20(26)16-9-6-12-23-19(16)22/h3-13H,2H2,1H3,(H,24,26) |
| InChIKey | JSGHLLVUJARFBS-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.35 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|