C22H24ClN3O3S — CID 60584101
N-[4-chloro-3-[ethyl(phenyl)sulfamoyl]phenyl]-1-cyanocyclohexane-1-carboxamide (PubChem CID 60584101) has the molecular formula C22H24ClN3O3S and a molecular weight of 445.97 g/mol. Its IUPAC name is N-[4-chloro-3-[ethyl(phenyl)sulfamoyl]phenyl]-1-cyanocyclohexane-1-carboxamide.
| Compound Name | N-[4-chloro-3-[ethyl(phenyl)sulfamoyl]phenyl]-1-cyanocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 60584101 |
| Molecular Formula | C22H24ClN3O3S |
| Molecular Weight | 445.97 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | N-[4-chloro-3-[ethyl(phenyl)sulfamoyl]phenyl]-1-cyanocyclohexane-1-carboxamide |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1cc(NC(=O)C2(C#N)CCCCC2)ccc1Cl |
| InChI | InChI=1S/C22H24ClN3O3S/c1-2-26(18-9-5-3-6-10-18)30(28,29)20-15-17(11-12-19(20)23)25-21(27)22(16-24)13-7-4-8-14-22/h3,5-6,9-12,15H,2,4,7-8,13-14H2,1H3,(H,25,27) |
| InChIKey | XDDCLVLCXDVKPG-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.97 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |