C21H17ClF2N2O3S — CID 43030093
N-[4-chloro-3-[ethyl(phenyl)sulfamoyl]phenyl]-2,5-difluorobenzamide (PubChem CID 43030093) has the molecular formula C21H17ClF2N2O3S and a molecular weight of 450.89 g/mol. Its IUPAC name is N-[4-chloro-3-[ethyl(phenyl)sulfamoyl]phenyl]-2,5-difluorobenzamide.
| Compound Name | N-[4-chloro-3-[ethyl(phenyl)sulfamoyl]phenyl]-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 43030093 |
| Molecular Formula | C21H17ClF2N2O3S |
| Molecular Weight | 450.89 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | N-[4-chloro-3-[ethyl(phenyl)sulfamoyl]phenyl]-2,5-difluorobenzamide |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1cc(NC(=O)c2cc(F)ccc2F)ccc1Cl |
| InChI | InChI=1S/C21H17ClF2N2O3S/c1-2-26(16-6-4-3-5-7-16)30(28,29)20-13-15(9-10-18(20)22)25-21(27)17-12-14(23)8-11-19(17)24/h3-13H,2H2,1H3,(H,25,27) |
| InChIKey | NYRYFLXVKNUANG-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.89 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |