C22H20Cl2N2O4S — CID 26578423
2,4-dichloro-5-[ethyl(phenyl)sulfamoyl]-N-(4-methoxyphenyl)benzamide (PubChem CID 26578423) has the molecular formula C22H20Cl2N2O4S and a molecular weight of 479.39 g/mol. Its IUPAC name is 2,4-dichloro-5-[ethyl(phenyl)sulfamoyl]-N-(4-methoxyphenyl)benzamide.
| Compound Name | 2,4-dichloro-5-[ethyl(phenyl)sulfamoyl]-N-(4-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 26578423 |
| Molecular Formula | C22H20Cl2N2O4S |
| Molecular Weight | 479.39 g/mol |
| Exact Mass | 478.05 |
| IUPAC Name | 2,4-dichloro-5-[ethyl(phenyl)sulfamoyl]-N-(4-methoxyphenyl)benzamide |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1cc(C(=O)Nc2ccc(OC)cc2)c(Cl)cc1Cl |
| InChI | InChI=1S/C22H20Cl2N2O4S/c1-3-26(16-7-5-4-6-8-16)31(28,29)21-13-18(19(23)14-20(21)24)22(27)25-15-9-11-17(30-2)12-10-15/h4-14H,3H2,1-2H3,(H,25,27) |
| InChIKey | HFPBCWGLGOKGIH-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.39 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |