C20H28N4O5S — CID 46489260
2-(4-ethyl-2,3-dioxopiperazin-1-yl)-N-(4-methyl-3-piperidin-1-ylsulfonylphenyl)acetamide (PubChem CID 46489260) has the molecular formula C20H28N4O5S and a molecular weight of 436.53 g/mol. Its IUPAC name is 2-(4-ethyl-2,3-dioxopiperazin-1-yl)-N-(4-methyl-3-piperidin-1-ylsulfonylphenyl)acetamide.
| Compound Name | 2-(4-ethyl-2,3-dioxopiperazin-1-yl)-N-(4-methyl-3-piperidin-1-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 46489260 |
| Molecular Formula | C20H28N4O5S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 2-(4-ethyl-2,3-dioxopiperazin-1-yl)-N-(4-methyl-3-piperidin-1-ylsulfonylphenyl)acetamide |
| SMILES | CCN1CCN(CC(=O)Nc2ccc(C)c(S(=O)(=O)N3CCCCC3)c2)C(=O)C1=O |
| InChI | InChI=1S/C20H28N4O5S/c1-3-22-11-12-23(20(27)19(22)26)14-18(25)21-16-8-7-15(2)17(13-16)30(28,29)24-9-5-4-6-10-24/h7-8,13H,3-6,9-12,14H2,1-2H3,(H,21,25) |
| InChIKey | IHERNIUKONDNQI-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|