C21H23ClN4O5S — CID 55787135
N-[3-[(2-chlorophenyl)sulfamoyl]-4-methylphenyl]-2-(4-ethyl-2,3-dioxopiperazin-1-yl)acetamide (PubChem CID 55787135) has the molecular formula C21H23ClN4O5S and a molecular weight of 478.96 g/mol. Its IUPAC name is N-[3-[(2-chlorophenyl)sulfamoyl]-4-methylphenyl]-2-(4-ethyl-2,3-dioxopiperazin-1-yl)acetamide.
| Compound Name | N-[3-[(2-chlorophenyl)sulfamoyl]-4-methylphenyl]-2-(4-ethyl-2,3-dioxopiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 55787135 |
| Molecular Formula | C21H23ClN4O5S |
| Molecular Weight | 478.96 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | N-[3-[(2-chlorophenyl)sulfamoyl]-4-methylphenyl]-2-(4-ethyl-2,3-dioxopiperazin-1-yl)acetamide |
| SMILES | CCN1CCN(CC(=O)Nc2ccc(C)c(S(=O)(=O)Nc3ccccc3Cl)c2)C(=O)C1=O |
| InChI | InChI=1S/C21H23ClN4O5S/c1-3-25-10-11-26(21(29)20(25)28)13-19(27)23-15-9-8-14(2)18(12-15)32(30,31)24-17-7-5-4-6-16(17)22/h4-9,12,24H,3,10-11,13H2,1-2H3,(H,23,27) |
| InChIKey | RHUXSVIOAFRYTE-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.96 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|