C23H24ClN3O6S — CID 5179877
N-[3-[(2-chlorophenyl)sulfamoyl]-4-methoxyphenyl]-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetamide (PubChem CID 5179877) has the molecular formula C23H24ClN3O6S and a molecular weight of 505.98 g/mol. Its IUPAC name is N-[3-[(2-chlorophenyl)sulfamoyl]-4-methoxyphenyl]-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetamide.
| Compound Name | N-[3-[(2-chlorophenyl)sulfamoyl]-4-methoxyphenyl]-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 5179877 |
| Molecular Formula | C23H24ClN3O6S |
| Molecular Weight | 505.98 g/mol |
| Exact Mass | 505.11 |
| IUPAC Name | N-[3-[(2-chlorophenyl)sulfamoyl]-4-methoxyphenyl]-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetamide |
| SMILES | COc1ccc(NC(=O)CN2C(=O)C3CCCCC3C2=O)cc1S(=O)(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C23H24ClN3O6S/c1-33-19-11-10-14(12-20(19)34(31,32)26-18-9-5-4-8-17(18)24)25-21(28)13-27-22(29)15-6-2-3-7-16(15)23(27)30/h4-5,8-12,15-16,26H,2-3,6-7,13H2,1H3,(H,25,28) |
| InChIKey | QUYCOAFRYYQNME-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.98 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|