C21H16ClF3N2O4S — CID 4312419
N-[3-[(2-chlorophenyl)sulfamoyl]-4-methoxyphenyl]-4-(trifluoromethyl)benzamide (PubChem CID 4312419) has the molecular formula C21H16ClF3N2O4S and a molecular weight of 484.88 g/mol. Its IUPAC name is N-[3-[(2-chlorophenyl)sulfamoyl]-4-methoxyphenyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[3-[(2-chlorophenyl)sulfamoyl]-4-methoxyphenyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 4312419 |
| Molecular Formula | C21H16ClF3N2O4S |
| Molecular Weight | 484.88 g/mol |
| Exact Mass | 484.05 |
| IUPAC Name | N-[3-[(2-chlorophenyl)sulfamoyl]-4-methoxyphenyl]-4-(trifluoromethyl)benzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(C(F)(F)F)cc2)cc1S(=O)(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C21H16ClF3N2O4S/c1-31-18-11-10-15(26-20(28)13-6-8-14(9-7-13)21(23,24)25)12-19(18)32(29,30)27-17-5-3-2-4-16(17)22/h2-12,27H,1H3,(H,26,28) |
| InChIKey | BVIDOMYUFZIVJD-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.88 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |