C23H20ClFN2O4S — CID 60575699
(Z)-N-[3-[(2-chlorophenyl)sulfamoyl]-4-methoxyphenyl]-3-(2-fluorophenyl)but-2-enamide (PubChem CID 60575699) has the molecular formula C23H20ClFN2O4S and a molecular weight of 474.94 g/mol. Its IUPAC name is (Z)-N-[3-[(2-chlorophenyl)sulfamoyl]-4-methoxyphenyl]-3-(2-fluorophenyl)but-2-enamide.
| Compound Name | (Z)-N-[3-[(2-chlorophenyl)sulfamoyl]-4-methoxyphenyl]-3-(2-fluorophenyl)but-2-enamide |
|---|---|
| PubChem CID | 60575699 |
| Molecular Formula | C23H20ClFN2O4S |
| Molecular Weight | 474.94 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | (Z)-N-[3-[(2-chlorophenyl)sulfamoyl]-4-methoxyphenyl]-3-(2-fluorophenyl)but-2-enamide |
| SMILES | COc1ccc(NC(=O)/C=C(/C)c2ccccc2F)cc1S(=O)(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C23H20ClFN2O4S/c1-15(17-7-3-5-9-19(17)25)13-23(28)26-16-11-12-21(31-2)22(14-16)32(29,30)27-20-10-6-4-8-18(20)24/h3-14,27H,1-2H3,(H,26,28)/b15-13- |
| InChIKey | VAFMTDKLIQTFPO-SQFISAMPSA-N |
| XLogP | 5.33 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.94 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|