C17H17FN2O4S — CID 76869379
3-(2-fluorophenyl)-N-(4-methoxy-3-sulfamoylphenyl)but-2-enamide (PubChem CID 76869379) has the molecular formula C17H17FN2O4S and a molecular weight of 364.40 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-N-(4-methoxy-3-sulfamoylphenyl)but-2-enamide.
| Compound Name | 3-(2-fluorophenyl)-N-(4-methoxy-3-sulfamoylphenyl)but-2-enamide |
|---|---|
| PubChem CID | 76869379 |
| Molecular Formula | C17H17FN2O4S |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | 3-(2-fluorophenyl)-N-(4-methoxy-3-sulfamoylphenyl)but-2-enamide |
| SMILES | COc1ccc(NC(=O)C=C(C)c2ccccc2F)cc1S(N)(=O)=O |
| InChI | InChI=1S/C17H17FN2O4S/c1-11(13-5-3-4-6-14(13)18)9-17(21)20-12-7-8-15(24-2)16(10-12)25(19,22)23/h3-10H,1-2H3,(H,20,21)(H2,19,22,23) |
| InChIKey | IIFYMRQADJPRSL-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|