C21H17FN2O5S — CID 55551358
2-(4-fluorobenzoyl)-N-(4-methoxy-3-sulfamoylphenyl)benzamide (PubChem CID 55551358) has the molecular formula C21H17FN2O5S and a molecular weight of 428.44 g/mol. Its IUPAC name is 2-(4-fluorobenzoyl)-N-(4-methoxy-3-sulfamoylphenyl)benzamide.
| Compound Name | 2-(4-fluorobenzoyl)-N-(4-methoxy-3-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 55551358 |
| Molecular Formula | C21H17FN2O5S |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | 2-(4-fluorobenzoyl)-N-(4-methoxy-3-sulfamoylphenyl)benzamide |
| SMILES | COc1ccc(NC(=O)c2ccccc2C(=O)c2ccc(F)cc2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C21H17FN2O5S/c1-29-18-11-10-15(12-19(18)30(23,27)28)24-21(26)17-5-3-2-4-16(17)20(25)13-6-8-14(22)9-7-13/h2-12H,1H3,(H,24,26)(H2,23,27,28) |
| InChIKey | MFVGXZFBZTWYFU-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |