C22H17ClN4O5S — CID 4007249
N-[3-[(2-chlorophenyl)sulfamoyl]-4-methoxyphenyl]-4-oxo-3H-phthalazine-1-carboxamide (PubChem CID 4007249) has the molecular formula C22H17ClN4O5S and a molecular weight of 484.92 g/mol. Its IUPAC name is N-[3-[(2-chlorophenyl)sulfamoyl]-4-methoxyphenyl]-4-oxo-3H-phthalazine-1-carboxamide.
| Compound Name | N-[3-[(2-chlorophenyl)sulfamoyl]-4-methoxyphenyl]-4-oxo-3H-phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 4007249 |
| Molecular Formula | C22H17ClN4O5S |
| Molecular Weight | 484.92 g/mol |
| Exact Mass | 484.06 |
| IUPAC Name | N-[3-[(2-chlorophenyl)sulfamoyl]-4-methoxyphenyl]-4-oxo-3H-phthalazine-1-carboxamide |
| SMILES | COc1ccc(NC(=O)c2n[nH]c(=O)c3ccccc23)cc1S(=O)(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C22H17ClN4O5S/c1-32-18-11-10-13(12-19(18)33(30,31)27-17-9-5-4-8-16(17)23)24-22(29)20-14-6-2-3-7-15(14)21(28)26-25-20/h2-12,27H,1H3,(H,24,29)(H,26,28) |
| InChIKey | PITJWIDKEPOAGS-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 130.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.92 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |