C21H18Cl2N2O4S2 — CID 24637119
2-chloro-N-[3-[(2-chlorophenyl)sulfamoyl]-4-methoxyphenyl]-5-methylsulfanylbenzamide (PubChem CID 24637119) has the molecular formula C21H18Cl2N2O4S2 and a molecular weight of 497.43 g/mol. Its IUPAC name is 2-chloro-N-[3-[(2-chlorophenyl)sulfamoyl]-4-methoxyphenyl]-5-methylsulfanylbenzamide.
| Compound Name | 2-chloro-N-[3-[(2-chlorophenyl)sulfamoyl]-4-methoxyphenyl]-5-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 24637119 |
| Molecular Formula | C21H18Cl2N2O4S2 |
| Molecular Weight | 497.43 g/mol |
| Exact Mass | 496.01 |
| IUPAC Name | 2-chloro-N-[3-[(2-chlorophenyl)sulfamoyl]-4-methoxyphenyl]-5-methylsulfanylbenzamide |
| SMILES | COc1ccc(NC(=O)c2cc(SC)ccc2Cl)cc1S(=O)(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C21H18Cl2N2O4S2/c1-29-19-10-7-13(24-21(26)15-12-14(30-2)8-9-16(15)22)11-20(19)31(27,28)25-18-6-4-3-5-17(18)23/h3-12,25H,1-2H3,(H,24,26) |
| InChIKey | DLVRQTQWVJQPRD-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.43 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |