C22H21ClN2O4S2 — CID 26642387
2-chloro-N-[3-[(4-methoxyphenyl)sulfamoyl]-4-methylphenyl]-5-methylsulfanylbenzamide (PubChem CID 26642387) has the molecular formula C22H21ClN2O4S2 and a molecular weight of 477.01 g/mol. Its IUPAC name is 2-chloro-N-[3-[(4-methoxyphenyl)sulfamoyl]-4-methylphenyl]-5-methylsulfanylbenzamide.
| Compound Name | 2-chloro-N-[3-[(4-methoxyphenyl)sulfamoyl]-4-methylphenyl]-5-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 26642387 |
| Molecular Formula | C22H21ClN2O4S2 |
| Molecular Weight | 477.01 g/mol |
| Exact Mass | 476.06 |
| IUPAC Name | 2-chloro-N-[3-[(4-methoxyphenyl)sulfamoyl]-4-methylphenyl]-5-methylsulfanylbenzamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cc(NC(=O)c3cc(SC)ccc3Cl)ccc2C)cc1 |
| InChI | InChI=1S/C22H21ClN2O4S2/c1-14-4-5-16(24-22(26)19-13-18(30-3)10-11-20(19)23)12-21(14)31(27,28)25-15-6-8-17(29-2)9-7-15/h4-13,25H,1-3H3,(H,24,26) |
| InChIKey | JAUJOEQANRCFSG-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.01 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |