C21H17ClF2N2O5S — CID 26851594
2-chloro-4,5-difluoro-N-[4-methoxy-3-[(4-methoxyphenyl)sulfamoyl]phenyl]benzamide (PubChem CID 26851594) has the molecular formula C21H17ClF2N2O5S and a molecular weight of 482.89 g/mol. Its IUPAC name is 2-chloro-4,5-difluoro-N-[4-methoxy-3-[(4-methoxyphenyl)sulfamoyl]phenyl]benzamide.
| Compound Name | 2-chloro-4,5-difluoro-N-[4-methoxy-3-[(4-methoxyphenyl)sulfamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 26851594 |
| Molecular Formula | C21H17ClF2N2O5S |
| Molecular Weight | 482.89 g/mol |
| Exact Mass | 482.05 |
| IUPAC Name | 2-chloro-4,5-difluoro-N-[4-methoxy-3-[(4-methoxyphenyl)sulfamoyl]phenyl]benzamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cc(NC(=O)c3cc(F)c(F)cc3Cl)ccc2OC)cc1 |
| InChI | InChI=1S/C21H17ClF2N2O5S/c1-30-14-6-3-12(4-7-14)26-32(28,29)20-9-13(5-8-19(20)31-2)25-21(27)15-10-17(23)18(24)11-16(15)22/h3-11,26H,1-2H3,(H,25,27) |
| InChIKey | PQGVYMGLCZBPFI-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.89 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|