C19H18ClF2NO3 — CID 31870921
2-chloro-N-(3-cyclopentyloxy-4-methoxyphenyl)-4,5-difluorobenzamide (PubChem CID 31870921) has the molecular formula C19H18ClF2NO3 and a molecular weight of 381.81 g/mol. Its IUPAC name is 2-chloro-N-(3-cyclopentyloxy-4-methoxyphenyl)-4,5-difluorobenzamide.
| Compound Name | 2-chloro-N-(3-cyclopentyloxy-4-methoxyphenyl)-4,5-difluorobenzamide |
|---|---|
| PubChem CID | 31870921 |
| Molecular Formula | C19H18ClF2NO3 |
| Molecular Weight | 381.81 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 2-chloro-N-(3-cyclopentyloxy-4-methoxyphenyl)-4,5-difluorobenzamide |
| SMILES | COc1ccc(NC(=O)c2cc(F)c(F)cc2Cl)cc1OC1CCCC1 |
| InChI | InChI=1S/C19H18ClF2NO3/c1-25-17-7-6-11(8-18(17)26-12-4-2-3-5-12)23-19(24)13-9-15(21)16(22)10-14(13)20/h6-10,12H,2-5H2,1H3,(H,23,24) |
| InChIKey | XODKSTYLVYITKN-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.81 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|