C19H20FNO3 — CID 10404302
3-cyclopentyloxy-N-(4-fluorophenyl)-4-methoxybenzamide (PubChem CID 10404302) has the molecular formula C19H20FNO3 and a molecular weight of 329.37 g/mol. Its IUPAC name is 3-cyclopentyloxy-N-(4-fluorophenyl)-4-methoxybenzamide.
| Compound Name | 3-cyclopentyloxy-N-(4-fluorophenyl)-4-methoxybenzamide |
|---|---|
| PubChem CID | 10404302 |
| Molecular Formula | C19H20FNO3 |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 3-cyclopentyloxy-N-(4-fluorophenyl)-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(F)cc2)cc1OC1CCCC1 |
| InChI | InChI=1S/C19H20FNO3/c1-23-17-11-6-13(12-18(17)24-16-4-2-3-5-16)19(22)21-15-9-7-14(20)8-10-15/h6-12,16H,2-5H2,1H3,(H,21,22) |
| InChIKey | FVBUBLWMUQVLTQ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |