C20H18ClN3O4S — CID 26642328
6-chloro-N-[3-[(4-methoxyphenyl)sulfamoyl]-4-methylphenyl]pyridine-3-carboxamide (PubChem CID 26642328) has the molecular formula C20H18ClN3O4S and a molecular weight of 431.90 g/mol. Its IUPAC name is 6-chloro-N-[3-[(4-methoxyphenyl)sulfamoyl]-4-methylphenyl]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-[3-[(4-methoxyphenyl)sulfamoyl]-4-methylphenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 26642328 |
| Molecular Formula | C20H18ClN3O4S |
| Molecular Weight | 431.90 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | 6-chloro-N-[3-[(4-methoxyphenyl)sulfamoyl]-4-methylphenyl]pyridine-3-carboxamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cc(NC(=O)c3ccc(Cl)nc3)ccc2C)cc1 |
| InChI | InChI=1S/C20H18ClN3O4S/c1-13-3-5-16(23-20(25)14-4-10-19(21)22-12-14)11-18(13)29(26,27)24-15-6-8-17(28-2)9-7-15/h3-12,24H,1-2H3,(H,23,25) |
| InChIKey | BDOVDZJIVQNPTC-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.90 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|