C23H23N3O6S — CID 35557182
3-(2-amino-2-oxoethoxy)-N-[3-[(4-methoxyphenyl)sulfamoyl]-4-methylphenyl]benzamide (PubChem CID 35557182) has the molecular formula C23H23N3O6S and a molecular weight of 469.52 g/mol. Its IUPAC name is 3-(2-amino-2-oxoethoxy)-N-[3-[(4-methoxyphenyl)sulfamoyl]-4-methylphenyl]benzamide.
| Compound Name | 3-(2-amino-2-oxoethoxy)-N-[3-[(4-methoxyphenyl)sulfamoyl]-4-methylphenyl]benzamide |
|---|---|
| PubChem CID | 35557182 |
| Molecular Formula | C23H23N3O6S |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | 3-(2-amino-2-oxoethoxy)-N-[3-[(4-methoxyphenyl)sulfamoyl]-4-methylphenyl]benzamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cc(NC(=O)c3cccc(OCC(N)=O)c3)ccc2C)cc1 |
| InChI | InChI=1S/C23H23N3O6S/c1-15-6-7-18(25-23(28)16-4-3-5-20(12-16)32-14-22(24)27)13-21(15)33(29,30)26-17-8-10-19(31-2)11-9-17/h3-13,26H,14H2,1-2H3,(H2,24,27)(H,25,28) |
| InChIKey | GHLTZXKLPFDQJZ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 136.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |