C22H17FN4O5S — CID 2496757
N-[3-[(4-fluorophenyl)sulfonylamino]-4-methoxyphenyl]-4-oxo-3H-phthalazine-1-carboxamide (PubChem CID 2496757) has the molecular formula C22H17FN4O5S and a molecular weight of 468.47 g/mol. Its IUPAC name is N-[3-[(4-fluorophenyl)sulfonylamino]-4-methoxyphenyl]-4-oxo-3H-phthalazine-1-carboxamide.
| Compound Name | N-[3-[(4-fluorophenyl)sulfonylamino]-4-methoxyphenyl]-4-oxo-3H-phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 2496757 |
| Molecular Formula | C22H17FN4O5S |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | N-[3-[(4-fluorophenyl)sulfonylamino]-4-methoxyphenyl]-4-oxo-3H-phthalazine-1-carboxamide |
| SMILES | COc1ccc(NC(=O)c2n[nH]c(=O)c3ccccc23)cc1NS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H17FN4O5S/c1-32-19-11-8-14(12-18(19)27-33(30,31)15-9-6-13(23)7-10-15)24-22(29)20-16-4-2-3-5-17(16)21(28)26-25-20/h2-12,27H,1H3,(H,24,29)(H,26,28) |
| InChIKey | JGGDEGCTALWKRC-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 130.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |