C16H12FN3O2 — CID 4163290
N-(3-fluoro-4-methylphenyl)-4-oxo-3H-phthalazine-1-carboxamide (PubChem CID 4163290) has the molecular formula C16H12FN3O2 and a molecular weight of 297.29 g/mol. Its IUPAC name is N-(3-fluoro-4-methylphenyl)-4-oxo-3H-phthalazine-1-carboxamide.
| Compound Name | N-(3-fluoro-4-methylphenyl)-4-oxo-3H-phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 4163290 |
| Molecular Formula | C16H12FN3O2 |
| Molecular Weight | 297.29 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | N-(3-fluoro-4-methylphenyl)-4-oxo-3H-phthalazine-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2n[nH]c(=O)c3ccccc23)cc1F |
| InChI | InChI=1S/C16H12FN3O2/c1-9-6-7-10(8-13(9)17)18-16(22)14-11-4-2-3-5-12(11)15(21)20-19-14/h2-8H,1H3,(H,18,22)(H,20,21) |
| InChIKey | VQWSFNNJSIKUFA-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.29 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |