C15H12N4O4S — CID 2103773
4-oxo-N-(4-sulfamoylphenyl)-3H-phthalazine-1-carboxamide (PubChem CID 2103773) has the molecular formula C15H12N4O4S and a molecular weight of 344.35 g/mol. Its IUPAC name is 4-oxo-N-(4-sulfamoylphenyl)-3H-phthalazine-1-carboxamide.
| Compound Name | 4-oxo-N-(4-sulfamoylphenyl)-3H-phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 2103773 |
| Molecular Formula | C15H12N4O4S |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | 4-oxo-N-(4-sulfamoylphenyl)-3H-phthalazine-1-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)c2n[nH]c(=O)c3ccccc23)cc1 |
| InChI | InChI=1S/C15H12N4O4S/c16-24(22,23)10-7-5-9(6-8-10)17-15(21)13-11-3-1-2-4-12(11)14(20)19-18-13/h1-8H,(H,17,21)(H,19,20)(H2,16,22,23) |
| InChIKey | RWCLHJONGNNQOV-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 135.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |