C14H15FN2O5S2 — CID 8903058
4-fluoro-N-[5-(methanesulfonamido)-2-methoxyphenyl]benzenesulfonamide (PubChem CID 8903058) has the molecular formula C14H15FN2O5S2 and a molecular weight of 374.42 g/mol. Its IUPAC name is 4-fluoro-N-[5-(methanesulfonamido)-2-methoxyphenyl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[5-(methanesulfonamido)-2-methoxyphenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 8903058 |
| Molecular Formula | C14H15FN2O5S2 |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | 4-fluoro-N-[5-(methanesulfonamido)-2-methoxyphenyl]benzenesulfonamide |
| SMILES | COc1ccc(NS(C)(=O)=O)cc1NS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H15FN2O5S2/c1-22-14-8-5-11(16-23(2,18)19)9-13(14)17-24(20,21)12-6-3-10(15)4-7-12/h3-9,16-17H,1-2H3 |
| InChIKey | DRNCHWNUQKXUOZ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |