C17H18FN3O3S2 — CID 8603844
1-cyclopropyl-3-[3-[(4-fluorophenyl)sulfonylamino]-4-methoxyphenyl]thiourea (PubChem CID 8603844) has the molecular formula C17H18FN3O3S2 and a molecular weight of 395.48 g/mol. Its IUPAC name is 1-cyclopropyl-3-[3-[(4-fluorophenyl)sulfonylamino]-4-methoxyphenyl]thiourea.
| Compound Name | 1-cyclopropyl-3-[3-[(4-fluorophenyl)sulfonylamino]-4-methoxyphenyl]thiourea |
|---|---|
| PubChem CID | 8603844 |
| Molecular Formula | C17H18FN3O3S2 |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | 1-cyclopropyl-3-[3-[(4-fluorophenyl)sulfonylamino]-4-methoxyphenyl]thiourea |
| SMILES | COc1ccc(NC(=S)NC2CC2)cc1NS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H18FN3O3S2/c1-24-16-9-6-13(20-17(25)19-12-4-5-12)10-15(16)21-26(22,23)14-7-2-11(18)3-8-14/h2-3,6-10,12,21H,4-5H2,1H3,(H2,19,20,25) |
| InChIKey | SLKYJHKZJGLTBO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|