C18H17Cl2FN2O4S — CID 43004633
2,2-dichloro-N-[3-[(4-fluorophenyl)sulfonylamino]-4-methoxyphenyl]-1-methylcyclopropane-1-carboxamide (PubChem CID 43004633) has the molecular formula C18H17Cl2FN2O4S and a molecular weight of 447.32 g/mol. Its IUPAC name is 2,2-dichloro-N-[3-[(4-fluorophenyl)sulfonylamino]-4-methoxyphenyl]-1-methylcyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-N-[3-[(4-fluorophenyl)sulfonylamino]-4-methoxyphenyl]-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 43004633 |
| Molecular Formula | C18H17Cl2FN2O4S |
| Molecular Weight | 447.32 g/mol |
| Exact Mass | 446.03 |
| IUPAC Name | 2,2-dichloro-N-[3-[(4-fluorophenyl)sulfonylamino]-4-methoxyphenyl]-1-methylcyclopropane-1-carboxamide |
| SMILES | COc1ccc(NC(=O)C2(C)CC2(Cl)Cl)cc1NS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H17Cl2FN2O4S/c1-17(10-18(17,19)20)16(24)22-12-5-8-15(27-2)14(9-12)23-28(25,26)13-6-3-11(21)4-7-13/h3-9,23H,10H2,1-2H3,(H,22,24) |
| InChIKey | NVBBUNDHJAUDBY-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.32 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|