C14H11F4NO3S — CID 3463733
4-fluoro-N-[2-methoxy-5-(trifluoromethyl)phenyl]benzenesulfonamide (PubChem CID 3463733) has the molecular formula C14H11F4NO3S and a molecular weight of 349.31 g/mol. Its IUPAC name is 4-fluoro-N-[2-methoxy-5-(trifluoromethyl)phenyl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[2-methoxy-5-(trifluoromethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 3463733 |
| Molecular Formula | C14H11F4NO3S |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | 4-fluoro-N-[2-methoxy-5-(trifluoromethyl)phenyl]benzenesulfonamide |
| SMILES | COc1ccc(C(F)(F)F)cc1NS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H11F4NO3S/c1-22-13-7-2-9(14(16,17)18)8-12(13)19-23(20,21)11-5-3-10(15)4-6-11/h2-8,19H,1H3 |
| InChIKey | IUNRGJOKGYNGDP-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |